C16H33NO2Si — CID 11022950
4-[(2S,3aS)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]butoxy-tert-butyl-dimethylsilane (PubChem CID 11022950) has the molecular formula C16H33NO2Si and a molecular weight of 299.53 g/mol. Its IUPAC name is 4-[(2S,3aS)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]butoxy-tert-butyl-dimethylsilane.
| Compound Name | 4-[(2S,3aS)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]butoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11022950 |
| Molecular Formula | C16H33NO2Si |
| Molecular Weight | 299.53 g/mol |
| Exact Mass | 299.23 |
| IUPAC Name | 4-[(2S,3aS)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]butoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC[C@H]1C[C@@H]2CCCN2O1 |
| InChI | InChI=1S/C16H33NO2Si/c1-16(2,3)20(4,5)18-12-7-6-10-15-13-14-9-8-11-17(14)19-15/h14-15H,6-13H2,1-5H3/t14-,15-/m0/s1 |
| InChIKey | PVAPBHDOJBABGU-GJZGRUSLSA-N |
| XLogP | 4.35 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|