C24H26N4O2S — CID 110230047
1-(1-methylpyrazole-3-carbonyl)-4-prop-2-enyl-6-[(4-thiophen-2-ylphenyl)methyl]-1,4-diazepan-5-one (PubChem CID 110230047) has the molecular formula C24H26N4O2S and a molecular weight of 434.57 g/mol. Its IUPAC name is 1-(1-methylpyrazole-3-carbonyl)-4-prop-2-enyl-6-[(4-thiophen-2-ylphenyl)methyl]-1,4-diazepan-5-one.
| Compound Name | 1-(1-methylpyrazole-3-carbonyl)-4-prop-2-enyl-6-[(4-thiophen-2-ylphenyl)methyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 110230047 |
| Molecular Formula | C24H26N4O2S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 1-(1-methylpyrazole-3-carbonyl)-4-prop-2-enyl-6-[(4-thiophen-2-ylphenyl)methyl]-1,4-diazepan-5-one |
| SMILES | C=CCN1CCN(C(=O)c2ccn(C)n2)CC(Cc2ccc(-c3cccs3)cc2)C1=O |
| InChI | InChI=1S/C24H26N4O2S/c1-3-11-27-13-14-28(24(30)21-10-12-26(2)25-21)17-20(23(27)29)16-18-6-8-19(9-7-18)22-5-4-15-31-22/h3-10,12,15,20H,1,11,13-14,16-17H2,2H3 |
| InChIKey | BIVWYWDDCXVKEY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|