C15H27NO5 — CID 11023009
tert-butyl (4aS,6R,8aR)-6-(hydroxymethyl)-2,2-dimethyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine-5-carboxylate (PubChem CID 11023009) has the molecular formula C15H27NO5 and a molecular weight of 301.38 g/mol. Its IUPAC name is tert-butyl (4aS,6R,8aR)-6-(hydroxymethyl)-2,2-dimethyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine-5-carboxylate.
| Compound Name | tert-butyl (4aS,6R,8aR)-6-(hydroxymethyl)-2,2-dimethyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 11023009 |
| Molecular Formula | C15H27NO5 |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | tert-butyl (4aS,6R,8aR)-6-(hydroxymethyl)-2,2-dimethyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](CO)CC[C@H]2OC(C)(C)OC[C@@H]21 |
| InChI | InChI=1S/C15H27NO5/c1-14(2,3)21-13(18)16-10(8-17)6-7-12-11(16)9-19-15(4,5)20-12/h10-12,17H,6-9H2,1-5H3/t10-,11+,12-/m1/s1 |
| InChIKey | HNIZVVVQRTXWBU-GRYCIOLGSA-N |
| XLogP | 1.90 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |