C12H15BrO4 — CID 11023073
(1R,4R,7S)-7-acetyl-5-bromo-3,3-dimethoxybicyclo[2.2.2]oct-5-en-2-one (PubChem CID 11023073) has the molecular formula C12H15BrO4 and a molecular weight of 303.15 g/mol. Its IUPAC name is (1R,4R,7S)-7-acetyl-5-bromo-3,3-dimethoxybicyclo[2.2.2]oct-5-en-2-one.
| Compound Name | (1R,4R,7S)-7-acetyl-5-bromo-3,3-dimethoxybicyclo[2.2.2]oct-5-en-2-one |
|---|---|
| PubChem CID | 11023073 |
| Molecular Formula | C12H15BrO4 |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | (1R,4R,7S)-7-acetyl-5-bromo-3,3-dimethoxybicyclo[2.2.2]oct-5-en-2-one |
| SMILES | COC1(OC)C(=O)[C@H]2C=C(Br)[C@@H]1C[C@@H]2C(C)=O |
| InChI | InChI=1S/C12H15BrO4/c1-6(14)7-4-9-10(13)5-8(7)11(15)12(9,16-2)17-3/h5,7-9H,4H2,1-3H3/t7-,8+,9+/m1/s1 |
| InChIKey | AUCHXSUIYVGSIB-VGMNWLOBSA-N |
| XLogP | 1.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|