C25H26N2O3S — CID 110230757
N-methyl-1-(2-phenoxyacetyl)-3-[(2-thiophen-2-ylphenyl)methyl]pyrrolidine-3-carboxamide (PubChem CID 110230757) has the molecular formula C25H26N2O3S and a molecular weight of 434.56 g/mol. Its IUPAC name is N-methyl-1-(2-phenoxyacetyl)-3-[(2-thiophen-2-ylphenyl)methyl]pyrrolidine-3-carboxamide.
| Compound Name | N-methyl-1-(2-phenoxyacetyl)-3-[(2-thiophen-2-ylphenyl)methyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 110230757 |
| Molecular Formula | C25H26N2O3S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | N-methyl-1-(2-phenoxyacetyl)-3-[(2-thiophen-2-ylphenyl)methyl]pyrrolidine-3-carboxamide |
| SMILES | CNC(=O)C1(Cc2ccccc2-c2cccs2)CCN(C(=O)COc2ccccc2)C1 |
| InChI | InChI=1S/C25H26N2O3S/c1-26-24(29)25(16-19-8-5-6-11-21(19)22-12-7-15-31-22)13-14-27(18-25)23(28)17-30-20-9-3-2-4-10-20/h2-12,15H,13-14,16-18H2,1H3,(H,26,29) |
| InChIKey | IBQJNFIUCVBBTI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |