C27H30N4O — CID 110231726
N-prop-2-enyl-1-(pyridin-2-ylmethyl)-3-[(2-pyridin-4-ylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 110231726) has the molecular formula C27H30N4O and a molecular weight of 426.56 g/mol. Its IUPAC name is N-prop-2-enyl-1-(pyridin-2-ylmethyl)-3-[(2-pyridin-4-ylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | N-prop-2-enyl-1-(pyridin-2-ylmethyl)-3-[(2-pyridin-4-ylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 110231726 |
| Molecular Formula | C27H30N4O |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | N-prop-2-enyl-1-(pyridin-2-ylmethyl)-3-[(2-pyridin-4-ylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | C=CCNC(=O)C1(Cc2ccccc2-c2ccncc2)CCCN(Cc2ccccn2)C1 |
| InChI | InChI=1S/C27H30N4O/c1-2-14-30-26(32)27(13-7-18-31(21-27)20-24-9-5-6-15-29-24)19-23-8-3-4-10-25(23)22-11-16-28-17-12-22/h2-6,8-12,15-17H,1,7,13-14,18-21H2,(H,30,32) |
| InChIKey | JSKFZVYQBJFSAA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|