C24H31N3O — CID 110231835
1-(cyclopropylmethyl)-N-ethyl-3-[(2-pyridin-3-ylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 110231835) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-N-ethyl-3-[(2-pyridin-3-ylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | 1-(cyclopropylmethyl)-N-ethyl-3-[(2-pyridin-3-ylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 110231835 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 1-(cyclopropylmethyl)-N-ethyl-3-[(2-pyridin-3-ylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | CCNC(=O)C1(Cc2ccccc2-c2cccnc2)CCCN(CC2CC2)C1 |
| InChI | InChI=1S/C24H31N3O/c1-2-26-23(28)24(12-6-14-27(18-24)17-19-10-11-19)15-20-7-3-4-9-22(20)21-8-5-13-25-16-21/h3-5,7-9,13,16,19H,2,6,10-12,14-15,17-18H2,1H3,(H,26,28) |
| InChIKey | LKXMRRUAZXDBAX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |