C26H31N3O2 — CID 110231872
1-(2-methylcyclopropanecarbonyl)-N-prop-2-enyl-3-[(2-pyridin-3-ylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 110231872) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is 1-(2-methylcyclopropanecarbonyl)-N-prop-2-enyl-3-[(2-pyridin-3-ylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | 1-(2-methylcyclopropanecarbonyl)-N-prop-2-enyl-3-[(2-pyridin-3-ylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 110231872 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 1-(2-methylcyclopropanecarbonyl)-N-prop-2-enyl-3-[(2-pyridin-3-ylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | C=CCNC(=O)C1(Cc2ccccc2-c2cccnc2)CCCN(C(=O)C2CC2C)C1 |
| InChI | InChI=1S/C26H31N3O2/c1-3-12-28-25(31)26(11-7-14-29(18-26)24(30)23-15-19(23)2)16-20-8-4-5-10-22(20)21-9-6-13-27-17-21/h3-6,8-10,13,17,19,23H,1,7,11-12,14-16,18H2,2H3,(H,28,31) |
| InChIKey | NUBMJSGJKIHWGQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|