C25H33N3O2 — CID 110232111
N-ethyl-1-(3-methylbutanoyl)-3-[(3-pyridin-4-ylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 110232111) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is N-ethyl-1-(3-methylbutanoyl)-3-[(3-pyridin-4-ylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | N-ethyl-1-(3-methylbutanoyl)-3-[(3-pyridin-4-ylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 110232111 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | N-ethyl-1-(3-methylbutanoyl)-3-[(3-pyridin-4-ylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | CCNC(=O)C1(Cc2cccc(-c3ccncc3)c2)CCCN(C(=O)CC(C)C)C1 |
| InChI | InChI=1S/C25H33N3O2/c1-4-27-24(30)25(11-6-14-28(18-25)23(29)15-19(2)3)17-20-7-5-8-22(16-20)21-9-12-26-13-10-21/h5,7-10,12-13,16,19H,4,6,11,14-15,17-18H2,1-3H3,(H,27,30) |
| InChIKey | QDJQHOLUIJXOFG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |