C26H33N3O2 — CID 110232207
1-(cyclopentanecarbonyl)-N-ethyl-3-[(3-pyridin-3-ylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 110232207) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is 1-(cyclopentanecarbonyl)-N-ethyl-3-[(3-pyridin-3-ylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | 1-(cyclopentanecarbonyl)-N-ethyl-3-[(3-pyridin-3-ylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 110232207 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | 1-(cyclopentanecarbonyl)-N-ethyl-3-[(3-pyridin-3-ylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | CCNC(=O)C1(Cc2cccc(-c3cccnc3)c2)CCCN(C(=O)C2CCCC2)C1 |
| InChI | InChI=1S/C26H33N3O2/c1-2-28-25(31)26(13-7-15-29(19-26)24(30)21-9-3-4-10-21)17-20-8-5-11-22(16-20)23-12-6-14-27-18-23/h5-6,8,11-12,14,16,18,21H,2-4,7,9-10,13,15,17,19H2,1H3,(H,28,31) |
| InChIKey | OSLGBYYPRCJPIQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |