C26H31FN2O2 — CID 110232783
1-(2,2-dimethylpropanoyl)-3-[[2-(2-fluorophenyl)phenyl]methyl]-N-prop-2-enylpyrrolidine-3-carboxamide (PubChem CID 110232783) has the molecular formula C26H31FN2O2 and a molecular weight of 422.54 g/mol. Its IUPAC name is 1-(2,2-dimethylpropanoyl)-3-[[2-(2-fluorophenyl)phenyl]methyl]-N-prop-2-enylpyrrolidine-3-carboxamide.
| Compound Name | 1-(2,2-dimethylpropanoyl)-3-[[2-(2-fluorophenyl)phenyl]methyl]-N-prop-2-enylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 110232783 |
| Molecular Formula | C26H31FN2O2 |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 1-(2,2-dimethylpropanoyl)-3-[[2-(2-fluorophenyl)phenyl]methyl]-N-prop-2-enylpyrrolidine-3-carboxamide |
| SMILES | C=CCNC(=O)C1(Cc2ccccc2-c2ccccc2F)CCN(C(=O)C(C)(C)C)C1 |
| InChI | InChI=1S/C26H31FN2O2/c1-5-15-28-23(30)26(14-16-29(18-26)24(31)25(2,3)4)17-19-10-6-7-11-20(19)21-12-8-9-13-22(21)27/h5-13H,1,14-18H2,2-4H3,(H,28,30) |
| InChIKey | DTHFGKMHCDKWTL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|