C25H27FN2O3 — CID 110232975
4-(cyclopropanecarbonyl)-2-[[2-(4-fluorophenyl)phenyl]methyl]-N-prop-2-enylmorpholine-2-carboxamide (PubChem CID 110232975) has the molecular formula C25H27FN2O3 and a molecular weight of 422.50 g/mol. Its IUPAC name is 4-(cyclopropanecarbonyl)-2-[[2-(4-fluorophenyl)phenyl]methyl]-N-prop-2-enylmorpholine-2-carboxamide.
| Compound Name | 4-(cyclopropanecarbonyl)-2-[[2-(4-fluorophenyl)phenyl]methyl]-N-prop-2-enylmorpholine-2-carboxamide |
|---|---|
| PubChem CID | 110232975 |
| Molecular Formula | C25H27FN2O3 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 4-(cyclopropanecarbonyl)-2-[[2-(4-fluorophenyl)phenyl]methyl]-N-prop-2-enylmorpholine-2-carboxamide |
| SMILES | C=CCNC(=O)C1(Cc2ccccc2-c2ccc(F)cc2)CN(C(=O)C2CC2)CCO1 |
| InChI | InChI=1S/C25H27FN2O3/c1-2-13-27-24(30)25(17-28(14-15-31-25)23(29)19-7-8-19)16-20-5-3-4-6-22(20)18-9-11-21(26)12-10-18/h2-6,9-12,19H,1,7-8,13-17H2,(H,27,30) |
| InChIKey | WPPFLTSLPDSQGS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|