About 1-methyl-3-[1-[(5-methylthiophen-2-yl)methyl]piperidin-3-yl]pyrazolo[3,4-b]pyrazine
1-methyl-3-[1-[(5-methylthiophen-2-yl)methyl]piperidin-3-yl]pyrazolo[3,4-b]pyrazine (PubChem CID 110234049) has the molecular formula C17H21N5S
and a molecular weight of 327.46 g/mol. Its IUPAC name is 1-methyl-3-[1-[(5-methylthiophen-2-yl)methyl]piperidin-3-yl]pyrazolo[3,4-b]pyrazine.
Molecular Properties
| Compound Name | 1-methyl-3-[1-[(5-methylthiophen-2-yl)methyl]piperidin-3-yl]pyrazolo[3,4-b]pyrazine |
| PubChem CID | 110234049 |
| Molecular Formula | C17H21N5S |
| Molecular Weight | 327.46 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 1-methyl-3-[1-[(5-methylthiophen-2-yl)methyl]piperidin-3-yl]pyrazolo[3,4-b]pyrazine |
| SMILES | Cc1ccc(CN2CCCC(c3nn(C)c4nccnc34)C2)s1 |
| InChI | InChI=1S/C17H21N5S/c1-12-5-6-14(23-12)11-22-9-3-4-13(10-22)15-16-17(21(2)20-15)19-8-7-18-16/h5-8,13H,3-4,9-11H2,1-2H3 |
| InChIKey | WFTVKSRXOOPFRK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-methyl-3-[1-[(5-methylthiophen-2-yl)methyl]piperidin-3-yl]pyrazolo[3,4-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-[1-[(5-methylthiophen-2-yl)methyl]piperidin-3-yl]pyrazolo[3,4-b]pyrazine?
The IUPAC name of 1-methyl-3-[1-[(5-methylthiophen-2-yl)methyl]piperidin-3-yl]pyrazolo[3,4-b]pyrazine (CID 110234049) is 1-methyl-3-[1-[(5-methylthiophen-2-yl)methyl]piperidin-3-yl]pyrazolo[3,4-b]pyrazine.
What is the SMILES notation for 1-methyl-3-[1-[(5-methylthiophen-2-yl)methyl]piperidin-3-yl]pyrazolo[3,4-b]pyrazine?
The canonical SMILES for 1-methyl-3-[1-[(5-methylthiophen-2-yl)methyl]piperidin-3-yl]pyrazolo[3,4-b]pyrazine is Cc1ccc(CN2CCCC(c3nn(C)c4nccnc34)C2)s1.
What is the InChIKey of 1-methyl-3-[1-[(5-methylthiophen-2-yl)methyl]piperidin-3-yl]pyrazolo[3,4-b]pyrazine?
The InChIKey is WFTVKSRXOOPFRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N5S/c1-12-5-6-14(23-12)11-22-9-3-4-13(10-22)15-16-17(21(2)20-15)19-8-7-18-16/h5-8,13H,3-4,9-11H2,1-2H3.
What are the key properties of 1-methyl-3-[1-[(5-methylthiophen-2-yl)methyl]piperidin-3-yl]pyrazolo[3,4-b]pyrazine?
1-methyl-3-[1-[(5-methylthiophen-2-yl)methyl]piperidin-3-yl]pyrazolo[3,4-b]pyrazine has a molecular weight of 327.46 g/mol, XLogP of 3.11, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-[1-[(5-methylthiophen-2-yl)methyl]piperidin-3-yl]pyrazolo[3,4-b]pyrazine is sourced from PubChem (CID 110234049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).