C6H2N6O10 — CID 11023554
2,3,4,5,6-pentanitroaniline (PubChem CID 11023554) has the molecular formula C6H2N6O10 and a molecular weight of 318.11 g/mol. Its IUPAC name is 2,3,4,5,6-pentanitroaniline.
| Compound Name | 2,3,4,5,6-pentanitroaniline |
|---|---|
| PubChem CID | 11023554 |
| Molecular Formula | C6H2N6O10 |
| Molecular Weight | 318.11 g/mol |
| Exact Mass | 317.98 |
| IUPAC Name | 2,3,4,5,6-pentanitroaniline |
| SMILES | Nc1c([N+](=O)[O-])c([N+](=O)[O-])c([N+](=O)[O-])c([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H2N6O10/c7-1-2(8(13)14)4(10(17)18)6(12(21)22)5(11(19)20)3(1)9(15)16/h7H2 |
| InChIKey | XJYDCCKHUXCATF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 241.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.11 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|