C21H24N2O — CID 11023651
N-(3,3-dimethylbutyl)-4-indol-1-ylbenzamide (PubChem CID 11023651) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-4-indol-1-ylbenzamide.
| Compound Name | N-(3,3-dimethylbutyl)-4-indol-1-ylbenzamide |
|---|---|
| PubChem CID | 11023651 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | N-(3,3-dimethylbutyl)-4-indol-1-ylbenzamide |
| SMILES | CC(C)(C)CCNC(=O)c1ccc(-n2ccc3ccccc32)cc1 |
| InChI | InChI=1S/C21H24N2O/c1-21(2,3)13-14-22-20(24)17-8-10-18(11-9-17)23-15-12-16-6-4-5-7-19(16)23/h4-12,15H,13-14H2,1-3H3,(H,22,24) |
| InChIKey | WFFDNQLEAMWQBV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |