C10H14BrNOSe — CID 11023729
(1S,7R)-3-bromo-7,10,10-trimethyl-4-oxa-3λ4-selena-5-azatricyclo[5.2.1.02,6]deca-2,5-diene (PubChem CID 11023729) has the molecular formula C10H14BrNOSe and a molecular weight of 323.09 g/mol. Its IUPAC name is (1S,7R)-3-bromo-7,10,10-trimethyl-4-oxa-3λ4-selena-5-azatricyclo[5.2.1.02,6]deca-2,5-diene.
| Compound Name | (1S,7R)-3-bromo-7,10,10-trimethyl-4-oxa-3λ4-selena-5-azatricyclo[5.2.1.02,6]deca-2,5-diene |
|---|---|
| PubChem CID | 11023729 |
| Molecular Formula | C10H14BrNOSe |
| Molecular Weight | 323.09 g/mol |
| Exact Mass | 322.94 |
| IUPAC Name | (1S,7R)-3-bromo-7,10,10-trimethyl-4-oxa-3λ4-selena-5-azatricyclo[5.2.1.02,6]deca-2,5-diene |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)C1=NO[Se](Br)=C12 |
| InChI | InChI=1S/C10H14BrNOSe/c1-9(2)6-4-5-10(9,3)8-7(6)14(11)13-12-8/h6H,4-5H2,1-3H3/t6-,10+,14?/m1/s1 |
| InChIKey | VIUBEQREVMXJAP-AEWZOGQFSA-N |
| XLogP | 2.47 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.09 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|