C24H30N4O2S — CID 110237463
12-benzyl-4-methyl-N-(3-methylbutan-2-yl)-2-oxo-6-thia-1,8,12-triazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide (PubChem CID 110237463) has the molecular formula C24H30N4O2S and a molecular weight of 438.60 g/mol. Its IUPAC name is 12-benzyl-4-methyl-N-(3-methylbutan-2-yl)-2-oxo-6-thia-1,8,12-triazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide.
| Compound Name | 12-benzyl-4-methyl-N-(3-methylbutan-2-yl)-2-oxo-6-thia-1,8,12-triazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide |
|---|---|
| PubChem CID | 110237463 |
| Molecular Formula | C24H30N4O2S |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 12-benzyl-4-methyl-N-(3-methylbutan-2-yl)-2-oxo-6-thia-1,8,12-triazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide |
| SMILES | Cc1c(C(=O)NC(C)C(C)C)sc2nc3n(c(=O)c12)CCN(Cc1ccccc1)CC3 |
| InChI | InChI=1S/C24H30N4O2S/c1-15(2)17(4)25-22(29)21-16(3)20-23(31-21)26-19-10-11-27(12-13-28(19)24(20)30)14-18-8-6-5-7-9-18/h5-9,15,17H,10-14H2,1-4H3,(H,25,29) |
| InChIKey | UVGFHSVZODSBIO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |