C21H27N5O2S — CID 110237473
5-methyl-12-[3-(3,4,5-trimethylpyrazol-1-yl)butanoyl]-6-thia-1,8,12-triazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-trien-2-one (PubChem CID 110237473) has the molecular formula C21H27N5O2S and a molecular weight of 413.55 g/mol. Its IUPAC name is 5-methyl-12-[3-(3,4,5-trimethylpyrazol-1-yl)butanoyl]-6-thia-1,8,12-triazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-trien-2-one.
| Compound Name | 5-methyl-12-[3-(3,4,5-trimethylpyrazol-1-yl)butanoyl]-6-thia-1,8,12-triazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-trien-2-one |
|---|---|
| PubChem CID | 110237473 |
| Molecular Formula | C21H27N5O2S |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 5-methyl-12-[3-(3,4,5-trimethylpyrazol-1-yl)butanoyl]-6-thia-1,8,12-triazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-trien-2-one |
| SMILES | Cc1cc2c(=O)n3c(nc2s1)CCN(C(=O)CC(C)n1nc(C)c(C)c1C)CC3 |
| InChI | InChI=1S/C21H27N5O2S/c1-12(26-16(5)14(3)15(4)23-26)10-19(27)24-7-6-18-22-20-17(11-13(2)29-20)21(28)25(18)9-8-24/h11-12H,6-10H2,1-5H3 |
| InChIKey | CKNSQELEAXYOFE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |