C19H24O3Si — CID 11023951
(2S,3R,4S)-2-[(2S)-2-hydroxypropyl]-1,1-diphenylsilolane-3,4-diol (PubChem CID 11023951) has the molecular formula C19H24O3Si and a molecular weight of 328.48 g/mol. Its IUPAC name is (2S,3R,4S)-2-[(2S)-2-hydroxypropyl]-1,1-diphenylsilolane-3,4-diol.
| Compound Name | (2S,3R,4S)-2-[(2S)-2-hydroxypropyl]-1,1-diphenylsilolane-3,4-diol |
|---|---|
| PubChem CID | 11023951 |
| Molecular Formula | C19H24O3Si |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (2S,3R,4S)-2-[(2S)-2-hydroxypropyl]-1,1-diphenylsilolane-3,4-diol |
| SMILES | C[C@H](O)C[C@H]1[C@H](O)[C@H](O)C[Si]1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H24O3Si/c1-14(20)12-18-19(22)17(21)13-23(18,15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11,14,17-22H,12-13H2,1H3/t14-,17+,18-,19+/m0/s1 |
| InChIKey | KQIVVSTVRASLJE-KLIQENQMSA-N |
| XLogP | 1.13 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|