C18H36O3Si — CID 11023957
propan-2-yl (2S,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhept-6-enoate (PubChem CID 11023957) has the molecular formula C18H36O3Si and a molecular weight of 328.57 g/mol. Its IUPAC name is propan-2-yl (2S,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhept-6-enoate.
| Compound Name | propan-2-yl (2S,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhept-6-enoate |
|---|---|
| PubChem CID | 11023957 |
| Molecular Formula | C18H36O3Si |
| Molecular Weight | 328.57 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | propan-2-yl (2S,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhept-6-enoate |
| SMILES | C=CC[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C(=O)OC(C)C |
| InChI | InChI=1S/C18H36O3Si/c1-11-12-14(4)16(15(5)17(19)20-13(2)3)21-22(9,10)18(6,7)8/h11,13-16H,1,12H2,2-10H3/t14-,15+,16+/m1/s1 |
| InChIKey | SZNQMZODXXCSJD-PMPSAXMXSA-N |
| XLogP | 5.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.57 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|