C22H27N5O4 — CID 110239748
1-[2-[2-[3-(5-amino-1-phenylpyrazole-4-carbonyl)pyrrolidin-1-yl]-2-oxoethoxy]ethyl]pyrrolidin-2-one (PubChem CID 110239748) has the molecular formula C22H27N5O4 and a molecular weight of 425.49 g/mol. Its IUPAC name is 1-[2-[2-[3-(5-amino-1-phenylpyrazole-4-carbonyl)pyrrolidin-1-yl]-2-oxoethoxy]ethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[2-[3-(5-amino-1-phenylpyrazole-4-carbonyl)pyrrolidin-1-yl]-2-oxoethoxy]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 110239748 |
| Molecular Formula | C22H27N5O4 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 1-[2-[2-[3-(5-amino-1-phenylpyrazole-4-carbonyl)pyrrolidin-1-yl]-2-oxoethoxy]ethyl]pyrrolidin-2-one |
| SMILES | Nc1c(C(=O)C2CCN(C(=O)COCCN3CCCC3=O)C2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C22H27N5O4/c23-22-18(13-24-27(22)17-5-2-1-3-6-17)21(30)16-8-10-26(14-16)20(29)15-31-12-11-25-9-4-7-19(25)28/h1-3,5-6,13,16H,4,7-12,14-15,23H2 |
| InChIKey | UETJNHFKGMUIBG-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 110.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|