C20H19N3Si — CID 11023983
5-methyl-11-trimethylsilylindolo[2,3-b]quinoline-9-carbonitrile (PubChem CID 11023983) has the molecular formula C20H19N3Si and a molecular weight of 329.48 g/mol. Its IUPAC name is 5-methyl-11-trimethylsilylindolo[2,3-b]quinoline-9-carbonitrile.
| Compound Name | 5-methyl-11-trimethylsilylindolo[2,3-b]quinoline-9-carbonitrile |
|---|---|
| PubChem CID | 11023983 |
| Molecular Formula | C20H19N3Si |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 5-methyl-11-trimethylsilylindolo[2,3-b]quinoline-9-carbonitrile |
| SMILES | Cn1c2nc3ccc(C#N)cc3c-2c([Si](C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C20H19N3Si/c1-23-17-8-6-5-7-14(17)19(24(2,3)4)18-15-11-13(12-21)9-10-16(15)22-20(18)23/h5-11H,1-4H3 |
| InChIKey | YGGNGQAANRIORY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|