C24H33N5O — CID 110239950
2-cyclohexyl-1-[3-[6-(dimethylamino)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-1-yl]ethanone (PubChem CID 110239950) has the molecular formula C24H33N5O and a molecular weight of 407.56 g/mol. Its IUPAC name is 2-cyclohexyl-1-[3-[6-(dimethylamino)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-1-yl]ethanone.
| Compound Name | 2-cyclohexyl-1-[3-[6-(dimethylamino)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 110239950 |
| Molecular Formula | C24H33N5O |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | 2-cyclohexyl-1-[3-[6-(dimethylamino)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-1-yl]ethanone |
| SMILES | CN(C)c1cc(C2CCCN(C(=O)CC3CCCCC3)C2)nc(-c2cccnc2)n1 |
| InChI | InChI=1S/C24H33N5O/c1-28(2)22-15-21(26-24(27-22)19-10-6-12-25-16-19)20-11-7-13-29(17-20)23(30)14-18-8-4-3-5-9-18/h6,10,12,15-16,18,20H,3-5,7-9,11,13-14,17H2,1-2H3 |
| InChIKey | IMSYHURRDWFNRY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |