About N-benzyl-2-(2,5-dimethoxy-N-methylsulfonylanilino)acetamide
N-benzyl-2-(2,5-dimethoxy-N-methylsulfonylanilino)acetamide (PubChem CID 1102401) has the molecular formula C18H22N2O5S
and a molecular weight of 378.45 g/mol. Its IUPAC name is N-benzyl-2-(2,5-dimethoxy-N-methylsulfonylanilino)acetamide.
Molecular Properties
| Compound Name | N-benzyl-2-(2,5-dimethoxy-N-methylsulfonylanilino)acetamide |
| PubChem CID | 1102401 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N-benzyl-2-(2,5-dimethoxy-N-methylsulfonylanilino)acetamide |
| SMILES | COc1ccc(OC)c(N(CC(=O)NCc2ccccc2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C18H22N2O5S/c1-24-15-9-10-17(25-2)16(11-15)20(26(3,22)23)13-18(21)19-12-14-7-5-4-6-8-14/h4-11H,12-13H2,1-3H3,(H,19,21) |
| InChIKey | WMJKQIPYVFYFIJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-benzyl-2-(2,5-dimethoxy-N-methylsulfonylanilino)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-(2,5-dimethoxy-N-methylsulfonylanilino)acetamide?
The IUPAC name of N-benzyl-2-(2,5-dimethoxy-N-methylsulfonylanilino)acetamide (CID 1102401) is N-benzyl-2-(2,5-dimethoxy-N-methylsulfonylanilino)acetamide.
What is the SMILES notation for N-benzyl-2-(2,5-dimethoxy-N-methylsulfonylanilino)acetamide?
The canonical SMILES for N-benzyl-2-(2,5-dimethoxy-N-methylsulfonylanilino)acetamide is COc1ccc(OC)c(N(CC(=O)NCc2ccccc2)S(C)(=O)=O)c1.
What is the InChIKey of N-benzyl-2-(2,5-dimethoxy-N-methylsulfonylanilino)acetamide?
The InChIKey is WMJKQIPYVFYFIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O5S/c1-24-15-9-10-17(25-2)16(11-15)20(26(3,22)23)13-18(21)19-12-14-7-5-4-6-8-14/h4-11H,12-13H2,1-3H3,(H,19,21).
What are the key properties of N-benzyl-2-(2,5-dimethoxy-N-methylsulfonylanilino)acetamide?
N-benzyl-2-(2,5-dimethoxy-N-methylsulfonylanilino)acetamide has a molecular weight of 378.45 g/mol, XLogP of 1.79, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-(2,5-dimethoxy-N-methylsulfonylanilino)acetamide is sourced from PubChem (CID 1102401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).