About N-[(Z)-1,2-diphenylethenyl]-1-(2-prop-2-ynoxyphenyl)methanimine
N-[(Z)-1,2-diphenylethenyl]-1-(2-prop-2-ynoxyphenyl)methanimine (PubChem CID 11024203) has the molecular formula C24H19NO
and a molecular weight of 337.42 g/mol. Its IUPAC name is N-[(Z)-1,2-diphenylethenyl]-1-(2-prop-2-ynoxyphenyl)methanimine.
Molecular Properties
| Compound Name | N-[(Z)-1,2-diphenylethenyl]-1-(2-prop-2-ynoxyphenyl)methanimine |
| PubChem CID | 11024203 |
| Molecular Formula | C24H19NO |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | N-[(Z)-1,2-diphenylethenyl]-1-(2-prop-2-ynoxyphenyl)methanimine |
| SMILES | C#CCOc1ccccc1/C=N/C(=C\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H19NO/c1-2-17-26-24-16-10-9-15-22(24)19-25-23(21-13-7-4-8-14-21)18-20-11-5-3-6-12-20/h1,3-16,18-19H,17H2/b23-18-,25-19+ |
| InChIKey | YNAKYCSXGIAKEO-VNLVBBAWSA-N |
| XLogP | 5.32 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-1,2-diphenylethenyl]-1-(2-prop-2-ynoxyphenyl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-1,2-diphenylethenyl]-1-(2-prop-2-ynoxyphenyl)methanimine?
The IUPAC name of N-[(Z)-1,2-diphenylethenyl]-1-(2-prop-2-ynoxyphenyl)methanimine (CID 11024203) is N-[(Z)-1,2-diphenylethenyl]-1-(2-prop-2-ynoxyphenyl)methanimine.
What is the SMILES notation for N-[(Z)-1,2-diphenylethenyl]-1-(2-prop-2-ynoxyphenyl)methanimine?
The canonical SMILES for N-[(Z)-1,2-diphenylethenyl]-1-(2-prop-2-ynoxyphenyl)methanimine is C#CCOc1ccccc1/C=N/C(=C\c1ccccc1)c1ccccc1.
What is the InChIKey of N-[(Z)-1,2-diphenylethenyl]-1-(2-prop-2-ynoxyphenyl)methanimine?
The InChIKey is YNAKYCSXGIAKEO-VNLVBBAWSA-N. The full InChI is InChI=1S/C24H19NO/c1-2-17-26-24-16-10-9-15-22(24)19-25-23(21-13-7-4-8-14-21)18-20-11-5-3-6-12-20/h1,3-16,18-19H,17H2/b23-18-,25-19+.
What are the key properties of N-[(Z)-1,2-diphenylethenyl]-1-(2-prop-2-ynoxyphenyl)methanimine?
N-[(Z)-1,2-diphenylethenyl]-1-(2-prop-2-ynoxyphenyl)methanimine has a molecular weight of 337.42 g/mol, XLogP of 5.32, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-1,2-diphenylethenyl]-1-(2-prop-2-ynoxyphenyl)methanimine is sourced from PubChem (CID 11024203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).