C14H12BrNO2S — CID 11024216
3-[2-(3-bromophenyl)-1,3-thiazol-4-yl]-5-methyloxolan-2-one (PubChem CID 11024216) has the molecular formula C14H12BrNO2S and a molecular weight of 338.23 g/mol. Its IUPAC name is 3-[2-(3-bromophenyl)-1,3-thiazol-4-yl]-5-methyloxolan-2-one.
| Compound Name | 3-[2-(3-bromophenyl)-1,3-thiazol-4-yl]-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 11024216 |
| Molecular Formula | C14H12BrNO2S |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | 3-[2-(3-bromophenyl)-1,3-thiazol-4-yl]-5-methyloxolan-2-one |
| SMILES | CC1CC(c2csc(-c3cccc(Br)c3)n2)C(=O)O1 |
| InChI | InChI=1S/C14H12BrNO2S/c1-8-5-11(14(17)18-8)12-7-19-13(16-12)9-3-2-4-10(15)6-9/h2-4,6-8,11H,5H2,1H3 |
| InChIKey | VANVSBQQWCGHRR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |