C18H26O6 — CID 11024229
dimethyl (2S)-2-[(1'S,7'aS)-7'a-methylspiro[1,3-dioxolane-2,5'-2,4,6,7-tetrahydro-1H-indene]-1'-yl]butanedioate (PubChem CID 11024229) has the molecular formula C18H26O6 and a molecular weight of 338.40 g/mol. Its IUPAC name is dimethyl (2S)-2-[(1'S,7'aS)-7'a-methylspiro[1,3-dioxolane-2,5'-2,4,6,7-tetrahydro-1H-indene]-1'-yl]butanedioate.
| Compound Name | dimethyl (2S)-2-[(1'S,7'aS)-7'a-methylspiro[1,3-dioxolane-2,5'-2,4,6,7-tetrahydro-1H-indene]-1'-yl]butanedioate |
|---|---|
| PubChem CID | 11024229 |
| Molecular Formula | C18H26O6 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | dimethyl (2S)-2-[(1'S,7'aS)-7'a-methylspiro[1,3-dioxolane-2,5'-2,4,6,7-tetrahydro-1H-indene]-1'-yl]butanedioate |
| SMILES | COC(=O)C[C@H](C(=O)OC)[C@@H]1CC=C2CC3(CC[C@]21C)OCCO3 |
| InChI | InChI=1S/C18H26O6/c1-17-6-7-18(23-8-9-24-18)11-12(17)4-5-14(17)13(16(20)22-3)10-15(19)21-2/h4,13-14H,5-11H2,1-3H3/t13-,14-,17+/m0/s1 |
| InChIKey | BBBPOMNIGSJADW-GRDNDAEWSA-N |
| XLogP | 2.22 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|