C18H30O4Si — CID 11024242
(2R,6S)-2-[(2S,3S)-2-[tert-butyl(dimethyl)silyl]oxyhex-5-yn-3-yl]oxy-6-methyl-2H-pyran-5-one (PubChem CID 11024242) has the molecular formula C18H30O4Si and a molecular weight of 338.52 g/mol. Its IUPAC name is (2R,6S)-2-[(2S,3S)-2-[tert-butyl(dimethyl)silyl]oxyhex-5-yn-3-yl]oxy-6-methyl-2H-pyran-5-one.
| Compound Name | (2R,6S)-2-[(2S,3S)-2-[tert-butyl(dimethyl)silyl]oxyhex-5-yn-3-yl]oxy-6-methyl-2H-pyran-5-one |
|---|---|
| PubChem CID | 11024242 |
| Molecular Formula | C18H30O4Si |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (2R,6S)-2-[(2S,3S)-2-[tert-butyl(dimethyl)silyl]oxyhex-5-yn-3-yl]oxy-6-methyl-2H-pyran-5-one |
| SMILES | C#CC[C@H](O[C@H]1C=CC(=O)[C@H](C)O1)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H30O4Si/c1-9-10-16(14(3)22-23(7,8)18(4,5)6)21-17-12-11-15(19)13(2)20-17/h1,11-14,16-17H,10H2,2-8H3/t13-,14-,16-,17-/m0/s1 |
| InChIKey | YEQLCKZNHWURNP-OTRWWLKZSA-N |
| XLogP | 3.68 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|