About 2-(4-chlorophenyl)-4,5-bis(trifluoromethyl)-1H-pyrrole-3-carbonitrile
2-(4-chlorophenyl)-4,5-bis(trifluoromethyl)-1H-pyrrole-3-carbonitrile (PubChem CID 11024245) has the molecular formula C13H5ClF6N2
and a molecular weight of 338.64 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4,5-bis(trifluoromethyl)-1H-pyrrole-3-carbonitrile.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-4,5-bis(trifluoromethyl)-1H-pyrrole-3-carbonitrile |
| PubChem CID | 11024245 |
| Molecular Formula | C13H5ClF6N2 |
| Molecular Weight | 338.64 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | 2-(4-chlorophenyl)-4,5-bis(trifluoromethyl)-1H-pyrrole-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(Cl)cc2)[nH]c(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C13H5ClF6N2/c14-7-3-1-6(2-4-7)10-8(5-21)9(12(15,16)17)11(22-10)13(18,19)20/h1-4,22H |
| InChIKey | CZGAFRIOZMOEKK-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.64 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4-chlorophenyl)-4,5-bis(trifluoromethyl)-1H-pyrrole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-4,5-bis(trifluoromethyl)-1H-pyrrole-3-carbonitrile?
The IUPAC name of 2-(4-chlorophenyl)-4,5-bis(trifluoromethyl)-1H-pyrrole-3-carbonitrile (CID 11024245) is 2-(4-chlorophenyl)-4,5-bis(trifluoromethyl)-1H-pyrrole-3-carbonitrile.
What is the SMILES notation for 2-(4-chlorophenyl)-4,5-bis(trifluoromethyl)-1H-pyrrole-3-carbonitrile?
The canonical SMILES for 2-(4-chlorophenyl)-4,5-bis(trifluoromethyl)-1H-pyrrole-3-carbonitrile is N#Cc1c(-c2ccc(Cl)cc2)[nH]c(C(F)(F)F)c1C(F)(F)F.
What is the InChIKey of 2-(4-chlorophenyl)-4,5-bis(trifluoromethyl)-1H-pyrrole-3-carbonitrile?
The InChIKey is CZGAFRIOZMOEKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H5ClF6N2/c14-7-3-1-6(2-4-7)10-8(5-21)9(12(15,16)17)11(22-10)13(18,19)20/h1-4,22H.
What are the key properties of 2-(4-chlorophenyl)-4,5-bis(trifluoromethyl)-1H-pyrrole-3-carbonitrile?
2-(4-chlorophenyl)-4,5-bis(trifluoromethyl)-1H-pyrrole-3-carbonitrile has a molecular weight of 338.64 g/mol, XLogP of 5.24, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-4,5-bis(trifluoromethyl)-1H-pyrrole-3-carbonitrile is sourced from PubChem (CID 11024245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).