About [(2R,3R,6R)-2-methyl-6-(11-oxododecyl)piperidin-3-yl] acetate
[(2R,3R,6R)-2-methyl-6-(11-oxododecyl)piperidin-3-yl] acetate (PubChem CID 11024260) has the molecular formula C20H37NO3
and a molecular weight of 339.52 g/mol. Its IUPAC name is [(2R,3R,6R)-2-methyl-6-(11-oxododecyl)piperidin-3-yl] acetate.
Molecular Properties
| Compound Name | [(2R,3R,6R)-2-methyl-6-(11-oxododecyl)piperidin-3-yl] acetate |
| PubChem CID | 11024260 |
| Molecular Formula | C20H37NO3 |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.28 |
| IUPAC Name | [(2R,3R,6R)-2-methyl-6-(11-oxododecyl)piperidin-3-yl] acetate |
| SMILES | CC(=O)CCCCCCCCCC[C@@H]1CC[C@@H](OC(C)=O)[C@@H](C)N1 |
| InChI | InChI=1S/C20H37NO3/c1-16(22)12-10-8-6-4-5-7-9-11-13-19-14-15-20(17(2)21-19)24-18(3)23/h17,19-21H,4-15H2,1-3H3/t17-,19-,20-/m1/s1 |
| InChIKey | AACOWOOKWQCRBQ-MISYRCLQSA-N |
| XLogP | 4.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(2R,3R,6R)-2-methyl-6-(11-oxododecyl)piperidin-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3R,6R)-2-methyl-6-(11-oxododecyl)piperidin-3-yl] acetate?
The IUPAC name of [(2R,3R,6R)-2-methyl-6-(11-oxododecyl)piperidin-3-yl] acetate (CID 11024260) is [(2R,3R,6R)-2-methyl-6-(11-oxododecyl)piperidin-3-yl] acetate.
What is the SMILES notation for [(2R,3R,6R)-2-methyl-6-(11-oxododecyl)piperidin-3-yl] acetate?
The canonical SMILES for [(2R,3R,6R)-2-methyl-6-(11-oxododecyl)piperidin-3-yl] acetate is CC(=O)CCCCCCCCCC[C@@H]1CC[C@@H](OC(C)=O)[C@@H](C)N1.
What is the InChIKey of [(2R,3R,6R)-2-methyl-6-(11-oxododecyl)piperidin-3-yl] acetate?
The InChIKey is AACOWOOKWQCRBQ-MISYRCLQSA-N. The full InChI is InChI=1S/C20H37NO3/c1-16(22)12-10-8-6-4-5-7-9-11-13-19-14-15-20(17(2)21-19)24-18(3)23/h17,19-21H,4-15H2,1-3H3/t17-,19-,20-/m1/s1.
What are the key properties of [(2R,3R,6R)-2-methyl-6-(11-oxododecyl)piperidin-3-yl] acetate?
[(2R,3R,6R)-2-methyl-6-(11-oxododecyl)piperidin-3-yl] acetate has a molecular weight of 339.52 g/mol, XLogP of 4.55, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3R,6R)-2-methyl-6-(11-oxododecyl)piperidin-3-yl] acetate is sourced from PubChem (CID 11024260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).