C15H20O9 — CID 11024373
2-O-[(2R,3R,3aR,6aS)-2-ethoxy-5-ethoxycarbonyl-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-3-yl] 1-O-ethyl oxalate (PubChem CID 11024373) has the molecular formula C15H20O9 and a molecular weight of 344.32 g/mol. Its IUPAC name is 2-O-[(2R,3R,3aR,6aS)-2-ethoxy-5-ethoxycarbonyl-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-3-yl] 1-O-ethyl oxalate.
| Compound Name | 2-O-[(2R,3R,3aR,6aS)-2-ethoxy-5-ethoxycarbonyl-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-3-yl] 1-O-ethyl oxalate |
|---|---|
| PubChem CID | 11024373 |
| Molecular Formula | C15H20O9 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 2-O-[(2R,3R,3aR,6aS)-2-ethoxy-5-ethoxycarbonyl-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-3-yl] 1-O-ethyl oxalate |
| SMILES | CCOC(=O)C(=O)O[C@H]1[C@H](OCC)O[C@H]2C=C(C(=O)OCC)O[C@@H]12 |
| InChI | InChI=1S/C15H20O9/c1-4-19-12(16)9-7-8-10(22-9)11(15(23-8)21-6-3)24-14(18)13(17)20-5-2/h7-8,10-11,15H,4-6H2,1-3H3/t8-,10+,11+,15+/m0/s1 |
| InChIKey | FZHZDIVLFKOWJK-HEVDRARRSA-N |
| XLogP | 0.07 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|