C22H23N3O4 — CID 110244568
furan-2-yl-[1-[4-methoxy-3-(pyrazol-1-ylmethyl)benzoyl]piperidin-4-yl]methanone (PubChem CID 110244568) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is furan-2-yl-[1-[4-methoxy-3-(pyrazol-1-ylmethyl)benzoyl]piperidin-4-yl]methanone.
| Compound Name | furan-2-yl-[1-[4-methoxy-3-(pyrazol-1-ylmethyl)benzoyl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 110244568 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | furan-2-yl-[1-[4-methoxy-3-(pyrazol-1-ylmethyl)benzoyl]piperidin-4-yl]methanone |
| SMILES | COc1ccc(C(=O)N2CCC(C(=O)c3ccco3)CC2)cc1Cn1cccn1 |
| InChI | InChI=1S/C22H23N3O4/c1-28-19-6-5-17(14-18(19)15-25-10-3-9-23-25)22(27)24-11-7-16(8-12-24)21(26)20-4-2-13-29-20/h2-6,9-10,13-14,16H,7-8,11-12,15H2,1H3 |
| InChIKey | HMZQDYLYCXOCSP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 77.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |