About trimethyl-[2,2,2-trifluoroethoxy-bis(trimethylsilyl)silyl]silane
trimethyl-[2,2,2-trifluoroethoxy-bis(trimethylsilyl)silyl]silane (PubChem CID 11024457) has the molecular formula C11H29F3OSi4
and a molecular weight of 346.69 g/mol. Its IUPAC name is trimethyl-[2,2,2-trifluoroethoxy-bis(trimethylsilyl)silyl]silane.
Molecular Properties
| Compound Name | trimethyl-[2,2,2-trifluoroethoxy-bis(trimethylsilyl)silyl]silane |
| PubChem CID | 11024457 |
| Molecular Formula | C11H29F3OSi4 |
| Molecular Weight | 346.69 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | trimethyl-[2,2,2-trifluoroethoxy-bis(trimethylsilyl)silyl]silane |
| SMILES | C[Si](C)(C)[Si](OCC(F)(F)F)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C11H29F3OSi4/c1-16(2,3)19(17(4,5)6,18(7,8)9)15-10-11(12,13)14/h10H2,1-9H3 |
| InChIKey | NNQPXSGEKCBEHB-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.69 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[2,2,2-trifluoroethoxy-bis(trimethylsilyl)silyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[2,2,2-trifluoroethoxy-bis(trimethylsilyl)silyl]silane?
The IUPAC name of trimethyl-[2,2,2-trifluoroethoxy-bis(trimethylsilyl)silyl]silane (CID 11024457) is trimethyl-[2,2,2-trifluoroethoxy-bis(trimethylsilyl)silyl]silane.
What is the SMILES notation for trimethyl-[2,2,2-trifluoroethoxy-bis(trimethylsilyl)silyl]silane?
The canonical SMILES for trimethyl-[2,2,2-trifluoroethoxy-bis(trimethylsilyl)silyl]silane is C[Si](C)(C)[Si](OCC(F)(F)F)([Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of trimethyl-[2,2,2-trifluoroethoxy-bis(trimethylsilyl)silyl]silane?
The InChIKey is NNQPXSGEKCBEHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H29F3OSi4/c1-16(2,3)19(17(4,5)6,18(7,8)9)15-10-11(12,13)14/h10H2,1-9H3.
What are the key properties of trimethyl-[2,2,2-trifluoroethoxy-bis(trimethylsilyl)silyl]silane?
trimethyl-[2,2,2-trifluoroethoxy-bis(trimethylsilyl)silyl]silane has a molecular weight of 346.69 g/mol, XLogP of 4.76, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[2,2,2-trifluoroethoxy-bis(trimethylsilyl)silyl]silane is sourced from PubChem (CID 11024457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).