C14H13FN2O2 — CID 110244642
[5-(4-fluorophenyl)-1,3-oxazol-4-yl]-pyrrolidin-1-ylmethanone (PubChem CID 110244642) has the molecular formula C14H13FN2O2 and a molecular weight of 260.27 g/mol. Its IUPAC name is [5-(4-fluorophenyl)-1,3-oxazol-4-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [5-(4-fluorophenyl)-1,3-oxazol-4-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 110244642 |
| Molecular Formula | C14H13FN2O2 |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | [5-(4-fluorophenyl)-1,3-oxazol-4-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1ncoc1-c1ccc(F)cc1)N1CCCC1 |
| InChI | InChI=1S/C14H13FN2O2/c15-11-5-3-10(4-6-11)13-12(16-9-19-13)14(18)17-7-1-2-8-17/h3-6,9H,1-2,7-8H2 |
| InChIKey | RRVIKAPBZBROPP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |