C18H24O5S — CID 11024592
(3R,6S)-6-[(E,2S)-5-(benzenesulfonyl)-2-hydroxy-3-methylpent-3-enyl]-3-methyloxan-2-one (PubChem CID 11024592) has the molecular formula C18H24O5S and a molecular weight of 352.45 g/mol. Its IUPAC name is (3R,6S)-6-[(E,2S)-5-(benzenesulfonyl)-2-hydroxy-3-methylpent-3-enyl]-3-methyloxan-2-one.
| Compound Name | (3R,6S)-6-[(E,2S)-5-(benzenesulfonyl)-2-hydroxy-3-methylpent-3-enyl]-3-methyloxan-2-one |
|---|---|
| PubChem CID | 11024592 |
| Molecular Formula | C18H24O5S |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | (3R,6S)-6-[(E,2S)-5-(benzenesulfonyl)-2-hydroxy-3-methylpent-3-enyl]-3-methyloxan-2-one |
| SMILES | C/C(=C\CS(=O)(=O)c1ccccc1)[C@@H](O)C[C@@H]1CC[C@@H](C)C(=O)O1 |
| InChI | InChI=1S/C18H24O5S/c1-13(10-11-24(21,22)16-6-4-3-5-7-16)17(19)12-15-9-8-14(2)18(20)23-15/h3-7,10,14-15,17,19H,8-9,11-12H2,1-2H3/b13-10+/t14-,15+,17+/m1/s1 |
| InChIKey | RHEFVFJMKJFECB-QPNSCCQMSA-N |
| XLogP | 2.50 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|