About 2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]-N-methyl-N-(2-phenylpropyl)acetamide
2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]-N-methyl-N-(2-phenylpropyl)acetamide (PubChem CID 110246294) has the molecular formula C23H32N4O
and a molecular weight of 380.54 g/mol. Its IUPAC name is 2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]-N-methyl-N-(2-phenylpropyl)acetamide.
Molecular Properties
| Compound Name | 2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]-N-methyl-N-(2-phenylpropyl)acetamide |
| PubChem CID | 110246294 |
| Molecular Formula | C23H32N4O |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | 2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]-N-methyl-N-(2-phenylpropyl)acetamide |
| SMILES | Cc1cc(C)nc(N2CCC(CC(=O)N(C)CC(C)c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C23H32N4O/c1-17(21-8-6-5-7-9-21)16-26(4)22(28)15-20-10-12-27(13-11-20)23-24-18(2)14-19(3)25-23/h5-9,14,17,20H,10-13,15-16H2,1-4H3 |
| InChIKey | OOMBPVZLUOBTAH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]-N-methyl-N-(2-phenylpropyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]-N-methyl-N-(2-phenylpropyl)acetamide?
The IUPAC name of 2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]-N-methyl-N-(2-phenylpropyl)acetamide (CID 110246294) is 2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]-N-methyl-N-(2-phenylpropyl)acetamide.
What is the SMILES notation for 2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]-N-methyl-N-(2-phenylpropyl)acetamide?
The canonical SMILES for 2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]-N-methyl-N-(2-phenylpropyl)acetamide is Cc1cc(C)nc(N2CCC(CC(=O)N(C)CC(C)c3ccccc3)CC2)n1.
What is the InChIKey of 2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]-N-methyl-N-(2-phenylpropyl)acetamide?
The InChIKey is OOMBPVZLUOBTAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H32N4O/c1-17(21-8-6-5-7-9-21)16-26(4)22(28)15-20-10-12-27(13-11-20)23-24-18(2)14-19(3)25-23/h5-9,14,17,20H,10-13,15-16H2,1-4H3.
What are the key properties of 2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]-N-methyl-N-(2-phenylpropyl)acetamide?
2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]-N-methyl-N-(2-phenylpropyl)acetamide has a molecular weight of 380.54 g/mol, XLogP of 3.96, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]-N-methyl-N-(2-phenylpropyl)acetamide is sourced from PubChem (CID 110246294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).