C23H21FN4O2 — CID 110247451
2-(1-benzoylpyrrolidin-2-yl)-N-(4-fluorophenyl)-4-methylpyrimidine-5-carboxamide (PubChem CID 110247451) has the molecular formula C23H21FN4O2 and a molecular weight of 404.45 g/mol. Its IUPAC name is 2-(1-benzoylpyrrolidin-2-yl)-N-(4-fluorophenyl)-4-methylpyrimidine-5-carboxamide.
| Compound Name | 2-(1-benzoylpyrrolidin-2-yl)-N-(4-fluorophenyl)-4-methylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 110247451 |
| Molecular Formula | C23H21FN4O2 |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 2-(1-benzoylpyrrolidin-2-yl)-N-(4-fluorophenyl)-4-methylpyrimidine-5-carboxamide |
| SMILES | Cc1nc(C2CCCN2C(=O)c2ccccc2)ncc1C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C23H21FN4O2/c1-15-19(22(29)27-18-11-9-17(24)10-12-18)14-25-21(26-15)20-8-5-13-28(20)23(30)16-6-3-2-4-7-16/h2-4,6-7,9-12,14,20H,5,8,13H2,1H3,(H,27,29) |
| InChIKey | QOXYCOQGKPTBOM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |