C23H27NO3 — CID 11024923
(6S,6aR,10R,10aS)-2-methoxy-10-methyl-4-phenyl-6-[(E)-prop-1-enyl]-6a,7,8,9,10,10a-hexahydro-6H-isochromeno[4,3-c]pyridin-1-one (PubChem CID 11024923) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is (6S,6aR,10R,10aS)-2-methoxy-10-methyl-4-phenyl-6-[(E)-prop-1-enyl]-6a,7,8,9,10,10a-hexahydro-6H-isochromeno[4,3-c]pyridin-1-one.
| Compound Name | (6S,6aR,10R,10aS)-2-methoxy-10-methyl-4-phenyl-6-[(E)-prop-1-enyl]-6a,7,8,9,10,10a-hexahydro-6H-isochromeno[4,3-c]pyridin-1-one |
|---|---|
| PubChem CID | 11024923 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | (6S,6aR,10R,10aS)-2-methoxy-10-methyl-4-phenyl-6-[(E)-prop-1-enyl]-6a,7,8,9,10,10a-hexahydro-6H-isochromeno[4,3-c]pyridin-1-one |
| SMILES | C/C=C/[C@@H]1Oc2c(-c3ccccc3)cn(OC)c(=O)c2[C@@H]2[C@H]1CCC[C@H]2C |
| InChI | InChI=1S/C23H27NO3/c1-4-9-19-17-13-8-10-15(2)20(17)21-22(27-19)18(14-24(26-3)23(21)25)16-11-6-5-7-12-16/h4-7,9,11-12,14-15,17,19-20H,8,10,13H2,1-3H3/b9-4+/t15-,17+,19+,20+/m1/s1 |
| InChIKey | ORZSZSIBAZFLLT-NGNDUIQYSA-N |
| XLogP | 4.43 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|