C25H25FN2O2 — CID 110249679
2-(4-fluorophenyl)-1-[3-[6-(4-methoxyphenyl)-2-pyridinyl]piperidin-1-yl]ethanone (PubChem CID 110249679) has the molecular formula C25H25FN2O2 and a molecular weight of 404.49 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1-[3-[6-(4-methoxyphenyl)-2-pyridinyl]piperidin-1-yl]ethanone.
| Compound Name | 2-(4-fluorophenyl)-1-[3-[6-(4-methoxyphenyl)-2-pyridinyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 110249679 |
| Molecular Formula | C25H25FN2O2 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 2-(4-fluorophenyl)-1-[3-[6-(4-methoxyphenyl)-2-pyridinyl]piperidin-1-yl]ethanone |
| SMILES | COc1ccc(-c2cccc(C3CCCN(C(=O)Cc4ccc(F)cc4)C3)n2)cc1 |
| InChI | InChI=1S/C25H25FN2O2/c1-30-22-13-9-19(10-14-22)23-5-2-6-24(27-23)20-4-3-15-28(17-20)25(29)16-18-7-11-21(26)12-8-18/h2,5-14,20H,3-4,15-17H2,1H3 |
| InChIKey | UNNNMHMVXTUTNU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |