C21H38O5 — CID 11025073
ethyl (E,4R)-4-hydroxy-14-(oxan-2-yloxy)tetradec-2-enoate (PubChem CID 11025073) has the molecular formula C21H38O5 and a molecular weight of 370.53 g/mol. Its IUPAC name is ethyl (E,4R)-4-hydroxy-14-(oxan-2-yloxy)tetradec-2-enoate.
| Compound Name | ethyl (E,4R)-4-hydroxy-14-(oxan-2-yloxy)tetradec-2-enoate |
|---|---|
| PubChem CID | 11025073 |
| Molecular Formula | C21H38O5 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | ethyl (E,4R)-4-hydroxy-14-(oxan-2-yloxy)tetradec-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](O)CCCCCCCCCCOC1CCCCO1 |
| InChI | InChI=1S/C21H38O5/c1-2-24-20(23)16-15-19(22)13-9-7-5-3-4-6-8-11-17-25-21-14-10-12-18-26-21/h15-16,19,21-22H,2-14,17-18H2,1H3/b16-15+/t19-,21?/m1/s1 |
| InChIKey | WNKAPHYBENLZBR-DZHPTHBTSA-N |
| XLogP | 4.52 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|