C22H26N4O4S — CID 110251310
3-[4-(1,5-dimethylpyrazole-4-carbonyl)morpholin-2-yl]-N-(2-methoxyethyl)-1-benzothiophene-2-carboxamide (PubChem CID 110251310) has the molecular formula C22H26N4O4S and a molecular weight of 442.54 g/mol. Its IUPAC name is 3-[4-(1,5-dimethylpyrazole-4-carbonyl)morpholin-2-yl]-N-(2-methoxyethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-[4-(1,5-dimethylpyrazole-4-carbonyl)morpholin-2-yl]-N-(2-methoxyethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 110251310 |
| Molecular Formula | C22H26N4O4S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 3-[4-(1,5-dimethylpyrazole-4-carbonyl)morpholin-2-yl]-N-(2-methoxyethyl)-1-benzothiophene-2-carboxamide |
| SMILES | COCCNC(=O)c1sc2ccccc2c1C1CN(C(=O)c2cnn(C)c2C)CCO1 |
| InChI | InChI=1S/C22H26N4O4S/c1-14-16(12-24-25(14)2)22(28)26-9-11-30-17(13-26)19-15-6-4-5-7-18(15)31-20(19)21(27)23-8-10-29-3/h4-7,12,17H,8-11,13H2,1-3H3,(H,23,27) |
| InChIKey | GRQXIQQILDWJMQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|