C11H11F3O4SSe — CID 11025179
[(8S)-8-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]selanyl trifluoromethanesulfonate (PubChem CID 11025179) has the molecular formula C11H11F3O4SSe and a molecular weight of 375.23 g/mol. Its IUPAC name is [(8S)-8-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]selanyl trifluoromethanesulfonate.
| Compound Name | [(8S)-8-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]selanyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11025179 |
| Molecular Formula | C11H11F3O4SSe |
| Molecular Weight | 375.23 g/mol |
| Exact Mass | 375.95 |
| IUPAC Name | [(8S)-8-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]selanyl trifluoromethanesulfonate |
| SMILES | O=S(=O)(O[Se]c1cccc2c1[C@@H](O)CCC2)C(F)(F)F |
| InChI | InChI=1S/C11H11F3O4SSe/c12-11(13,14)19(16,17)18-20-9-6-2-4-7-3-1-5-8(15)10(7)9/h2,4,6,8,15H,1,3,5H2/t8-/m0/s1 |
| InChIKey | XGZDFBFPYKALFO-QMMMGPOBSA-N |
| XLogP | 1.17 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.23 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|