C22H21N3O3 — CID 11025188
(8-phenyl-9-oxa-2,14-diazatricyclo[8.4.0.02,6]tetradeca-1(10),3,5,7,11,13-hexaen-7-yl) N,N-diethylcarbamate (PubChem CID 11025188) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is (8-phenyl-9-oxa-2,14-diazatricyclo[8.4.0.02,6]tetradeca-1(10),3,5,7,11,13-hexaen-7-yl) N,N-diethylcarbamate.
| Compound Name | (8-phenyl-9-oxa-2,14-diazatricyclo[8.4.0.02,6]tetradeca-1(10),3,5,7,11,13-hexaen-7-yl) N,N-diethylcarbamate |
|---|---|
| PubChem CID | 11025188 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | (8-phenyl-9-oxa-2,14-diazatricyclo[8.4.0.02,6]tetradeca-1(10),3,5,7,11,13-hexaen-7-yl) N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)OC1=C(c2ccccc2)Oc2cccnc2-n2cccc21 |
| InChI | InChI=1S/C22H21N3O3/c1-3-24(4-2)22(26)28-20-17-12-9-15-25(17)21-18(13-8-14-23-21)27-19(20)16-10-6-5-7-11-16/h5-15H,3-4H2,1-2H3 |
| InChIKey | KWIRXYGAYVTROX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |