C19H26N2O6 — CID 11025260
dimethyl (1R,2R,9S,17S)-6,12-dioxo-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecane-5,5-dicarboxylate (PubChem CID 11025260) has the molecular formula C19H26N2O6 and a molecular weight of 378.43 g/mol. Its IUPAC name is dimethyl (1R,2R,9S,17S)-6,12-dioxo-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecane-5,5-dicarboxylate.
| Compound Name | dimethyl (1R,2R,9S,17S)-6,12-dioxo-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecane-5,5-dicarboxylate |
|---|---|
| PubChem CID | 11025260 |
| Molecular Formula | C19H26N2O6 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | dimethyl (1R,2R,9S,17S)-6,12-dioxo-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecane-5,5-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC[C@@H]2[C@H]3CCCN4C(=O)CC[C@@H](CN2C1=O)[C@@H]34 |
| InChI | InChI=1S/C19H26N2O6/c1-26-17(24)19(18(25)27-2)8-7-13-12-4-3-9-20-14(22)6-5-11(15(12)20)10-21(13)16(19)23/h11-13,15H,3-10H2,1-2H3/t11-,12+,13+,15-/m0/s1 |
| InChIKey | YCXXTCONRMKYFC-JLNYLFASSA-N |
| XLogP | 0.34 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|