C15H22N2O2 — CID 110252960
1-[6-(methoxymethyl)-1,4-diazepan-1-yl]-2-phenylethanone (PubChem CID 110252960) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-[6-(methoxymethyl)-1,4-diazepan-1-yl]-2-phenylethanone.
| Compound Name | 1-[6-(methoxymethyl)-1,4-diazepan-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 110252960 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 1-[6-(methoxymethyl)-1,4-diazepan-1-yl]-2-phenylethanone |
| SMILES | COCC1CNCCN(C(=O)Cc2ccccc2)C1 |
| InChI | InChI=1S/C15H22N2O2/c1-19-12-14-10-16-7-8-17(11-14)15(18)9-13-5-3-2-4-6-13/h2-6,14,16H,7-12H2,1H3 |
| InChIKey | NJLVKURSMGHUBH-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |