C19H16ClF3N2O — CID 11025327
(4S)-6-chloro-4-ethenyl-3-[(1R)-1-phenylethyl]-4-(trifluoromethyl)-1H-quinazolin-2-one (PubChem CID 11025327) has the molecular formula C19H16ClF3N2O and a molecular weight of 380.80 g/mol. Its IUPAC name is (4S)-6-chloro-4-ethenyl-3-[(1R)-1-phenylethyl]-4-(trifluoromethyl)-1H-quinazolin-2-one.
| Compound Name | (4S)-6-chloro-4-ethenyl-3-[(1R)-1-phenylethyl]-4-(trifluoromethyl)-1H-quinazolin-2-one |
|---|---|
| PubChem CID | 11025327 |
| Molecular Formula | C19H16ClF3N2O |
| Molecular Weight | 380.80 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | (4S)-6-chloro-4-ethenyl-3-[(1R)-1-phenylethyl]-4-(trifluoromethyl)-1H-quinazolin-2-one |
| SMILES | C=C[C@@]1(C(F)(F)F)c2cc(Cl)ccc2NC(=O)N1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C19H16ClF3N2O/c1-3-18(19(21,22)23)15-11-14(20)9-10-16(15)24-17(26)25(18)12(2)13-7-5-4-6-8-13/h3-12H,1H2,2H3,(H,24,26)/t12-,18+/m1/s1 |
| InChIKey | MMESVTNXOLNYIB-XIKOKIGWSA-N |
| XLogP | 5.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.80 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|