C21H31N5 — CID 110253561
2-(1-cyclohexylpiperidin-3-yl)-6-(2-propan-2-ylimidazol-1-yl)pyrazine (PubChem CID 110253561) has the molecular formula C21H31N5 and a molecular weight of 353.51 g/mol. Its IUPAC name is 2-(1-cyclohexylpiperidin-3-yl)-6-(2-propan-2-ylimidazol-1-yl)pyrazine.
| Compound Name | 2-(1-cyclohexylpiperidin-3-yl)-6-(2-propan-2-ylimidazol-1-yl)pyrazine |
|---|---|
| PubChem CID | 110253561 |
| Molecular Formula | C21H31N5 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | 2-(1-cyclohexylpiperidin-3-yl)-6-(2-propan-2-ylimidazol-1-yl)pyrazine |
| SMILES | CC(C)c1nccn1-c1cncc(C2CCCN(C3CCCCC3)C2)n1 |
| InChI | InChI=1S/C21H31N5/c1-16(2)21-23-10-12-26(21)20-14-22-13-19(24-20)17-7-6-11-25(15-17)18-8-4-3-5-9-18/h10,12-14,16-18H,3-9,11,15H2,1-2H3 |
| InChIKey | XNVDQWVKMOKSNP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |