C26H22FNO — CID 11025398
(5Z)-5-benzylidene-7-fluoro-2,2,4-trimethyl-1H-chromeno[3,4-f]quinoline (PubChem CID 11025398) has the molecular formula C26H22FNO and a molecular weight of 383.47 g/mol. Its IUPAC name is (5Z)-5-benzylidene-7-fluoro-2,2,4-trimethyl-1H-chromeno[3,4-f]quinoline.
| Compound Name | (5Z)-5-benzylidene-7-fluoro-2,2,4-trimethyl-1H-chromeno[3,4-f]quinoline |
|---|---|
| PubChem CID | 11025398 |
| Molecular Formula | C26H22FNO |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | (5Z)-5-benzylidene-7-fluoro-2,2,4-trimethyl-1H-chromeno[3,4-f]quinoline |
| SMILES | CC1=CC(C)(C)Nc2ccc3c(c21)/C(=C/c1ccccc1)Oc1c(F)cccc1-3 |
| InChI | InChI=1S/C26H22FNO/c1-16-15-26(2,3)28-21-13-12-18-19-10-7-11-20(27)25(19)29-22(24(18)23(16)21)14-17-8-5-4-6-9-17/h4-15,28H,1-3H3/b22-14- |
| InChIKey | RTLRJRHSVSOAFD-HMAPJEAMSA-N |
| XLogP | 6.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|