C14H23N3 — CID 110254196
4,6-dimethyl-2-(1-propan-2-ylpiperidin-3-yl)pyrimidine (PubChem CID 110254196) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is 4,6-dimethyl-2-(1-propan-2-ylpiperidin-3-yl)pyrimidine.
| Compound Name | 4,6-dimethyl-2-(1-propan-2-ylpiperidin-3-yl)pyrimidine |
|---|---|
| PubChem CID | 110254196 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 4,6-dimethyl-2-(1-propan-2-ylpiperidin-3-yl)pyrimidine |
| SMILES | Cc1cc(C)nc(C2CCCN(C(C)C)C2)n1 |
| InChI | InChI=1S/C14H23N3/c1-10(2)17-7-5-6-13(9-17)14-15-11(3)8-12(4)16-14/h8,10,13H,5-7,9H2,1-4H3 |
| InChIKey | UATRVSULFIGKJG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |