C12H18N4O — CID 110254201
1-[3-(2-amino-5-methylpyrimidin-4-yl)piperidin-1-yl]ethanone (PubChem CID 110254201) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-[3-(2-amino-5-methylpyrimidin-4-yl)piperidin-1-yl]ethanone.
| Compound Name | 1-[3-(2-amino-5-methylpyrimidin-4-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 110254201 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 1-[3-(2-amino-5-methylpyrimidin-4-yl)piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCCC(c2nc(N)ncc2C)C1 |
| InChI | InChI=1S/C12H18N4O/c1-8-6-14-12(13)15-11(8)10-4-3-5-16(7-10)9(2)17/h6,10H,3-5,7H2,1-2H3,(H2,13,14,15) |
| InChIKey | YNWYMCUXGYYCQZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |